CAS 76089-04-8 is the registry number for 2,3-Dichloro-6-fluoroquinoxaline, 98+%. Offered by: AmBeed. Available pack sizes: 1g.
2,3-dichloro-6-fluoroquinoxaline (CAS 76089-04-8) is a chemical compound with the molecular formula C8H3Cl2FN2 and a molecular weight of 217.02 g/mol. IUPAC name: 2,3-dichloro-6-fluoroquinoxaline. InChIKey: VVVJWGDOTVMBNA-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2FN2 |
|---|---|
| Molecular weight | 217.02 g/mol |
| IUPAC name | 2,3-dichloro-6-fluoroquinoxaline |
| InChIKey | VVVJWGDOTVMBNA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)N=C(C(=N2)Cl)Cl |
Computed by PubChem (NCBI)