CAS 134517-57-0 appears in our catalog under these names: 2,4-Dichloro-6-fluoroquinazoline, 95%, 2,4–Dichloro–6–fluoroquinazoline, 2,4-dichloro-6-fluoroquinazoline, 2,4-Dichloro-6-fluoroquinazoline 97%, 2,4-Dichloro-6-fluoroquinazoline, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 25g, 5g, 10g, 1g, 250mg, 100mg.
2,4-dichloro-6-fluoroquinazoline (CAS 134517-57-0) is a chemical compound with the molecular formula C8H3Cl2FN2 and a molecular weight of 217.02 g/mol. IUPAC name: 2,4-dichloro-6-fluoroquinazoline. InChIKey: VLPYLGGGYDUVJN-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2FN2 |
|---|---|
| Molecular weight | 217.02 g/mol |
| IUPAC name | 2,4-dichloro-6-fluoroquinazoline |
| InChIKey | VLPYLGGGYDUVJN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)