Products 1566238-41-2

CAS 1566238-41-2 is the registry number for 6-Methoxy-2,2-dimethylhexanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

6-methoxy-2,2-dimethylhexanoic acid (CAS 1566238-41-2) is a chemical compound with the molecular formula C9H18O3 and a molecular weight of 174.24 g/mol. IUPAC name: 6-methoxy-2,2-dimethylhexanoic acid. InChIKey: XJCRWIKSLDPWDM-UHFFFAOYSA-N.

Identity
Molecular formulaC9H18O3
Molecular weight174.24 g/mol
IUPAC name6-methoxy-2,2-dimethylhexanoic acid
InChIKeyXJCRWIKSLDPWDM-UHFFFAOYSA-N
SMILESCC(C)(CCCCOC)C(=O)O

Computed by PubChem (NCBI)