Products 214193-70-1

CAS 214193-70-1 is the registry number for 3-Hydroxy-4,4-dimethyl-pentanoic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 3-hydroxy-4,4-dimethylpentanoate (CAS 214193-70-1) is a chemical compound with the molecular formula C9H18O3 and a molecular weight of 174.24 g/mol. IUPAC name: ethyl 3-hydroxy-4,4-dimethylpentanoate. InChIKey: QVXYZSSTMJIRPF-UHFFFAOYSA-N.

Identity
Molecular formulaC9H18O3
Molecular weight174.24 g/mol
IUPAC nameethyl 3-hydroxy-4,4-dimethylpentanoate
InChIKeyQVXYZSSTMJIRPF-UHFFFAOYSA-N
SMILESCCOC(=O)CC(C(C)(C)C)O

Computed by PubChem (NCBI)