CAS 15663-10-2 is the registry number for Bis(tropolonato)copper, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
Copper bis(7-oxocyclohepta-1,3,5-trien-1-olate) (CAS 15663-10-2) is a chemical compound with the molecular formula C14H10CuO4 and a molecular weight of 305.77 g/mol. IUPAC name: copper bis(7-oxocyclohepta-1,3,5-trien-1-olate). InChIKey: JBUPAQOHIYVYBH-UHFFFAOYSA-L.
| Molecular formula | C14H10CuO4 |
|---|---|
| Molecular weight | 305.77 g/mol |
| IUPAC name | copper bis(7-oxocyclohepta-1,3,5-trien-1-olate) |
| InChIKey | JBUPAQOHIYVYBH-UHFFFAOYSA-L |
| SMILES | C1=CC=C(C(=O)C=C1)[O-].C1=CC=C(C(=O)C=C1)[O-].[Cu+2] |
Computed by PubChem (NCBI)