CAS 533-01-7 appears in our catalog under these names: Cupric benzoate, 95%, Copper(II) benzoate, 97%, Copper(II) benzoate, 97%, 97%. Offered by: Combi-blocks, Chemat Brand, Chemat. Available pack sizes: 1g, 100mg, on request, 250mg.
Copper dibenzoate (CAS 533-01-7) is a chemical compound with the molecular formula C14H10CuO4 and a molecular weight of 305.77 g/mol. IUPAC name: copper dibenzoate. InChIKey: YEOCHZFPBYUXMC-UHFFFAOYSA-L.
| Molecular formula | C14H10CuO4 |
|---|---|
| Molecular weight | 305.77 g/mol |
| IUPAC name | copper dibenzoate |
| InChIKey | YEOCHZFPBYUXMC-UHFFFAOYSA-L |
| SMILES | C1=CC=C(C=C1)C(=O)[O-].C1=CC=C(C=C1)C(=O)[O-].[Cu+2] |
Computed by PubChem (NCBI)