Products 1566376-30-4
CAS 1566376-30-4 is the registry number for 3,5-dibromo-2-(cyclopropylmethoxy)pyridine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3,5-dibromo-2-(cyclopropylmethoxy)pyridine (CAS 1566376-30-4) is a chemical compound with the molecular formula C9H9Br2NO and a molecular weight of 306.98 g/mol. IUPAC name: 3,5-dibromo-2-(cyclopropylmethoxy)pyridine. InChIKey: IJZGPNLEOTVACN-UHFFFAOYSA-N.
| Molecular formula | C9H9Br2NO |
|---|---|
| Molecular weight | 306.98 g/mol |
| IUPAC name | 3,5-dibromo-2-(cyclopropylmethoxy)pyridine |
| InChIKey | IJZGPNLEOTVACN-UHFFFAOYSA-N |
| SMILES | C1CC1COC2=C(C=C(C=N2)Br)Br |
Computed by PubChem (NCBI)