CAS 1566922-60-8 appears in our catalog under these names: 6-Bromo-7-fluoroquinolin-2(1h)-one, 95%, 6-Bromo-7-fluoro-1,2-dihydroquinolin-2-one, 95%, 6-Bromo-7-fluoroquinolin-2(1H)-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 1g, 100mg.
6-bromo-7-fluoro-1H-quinolin-2-one (CAS 1566922-60-8) is a chemical compound with the molecular formula C9H5BrFNO and a molecular weight of 242.04 g/mol. IUPAC name: 6-bromo-7-fluoro-1H-quinolin-2-one. InChIKey: NJFSIMDTFFXIHB-UHFFFAOYSA-N.
| Molecular formula | C9H5BrFNO |
|---|---|
| Molecular weight | 242.04 g/mol |
| IUPAC name | 6-bromo-7-fluoro-1H-quinolin-2-one |
| InChIKey | NJFSIMDTFFXIHB-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)NC2=CC(=C(C=C21)Br)F |
Computed by PubChem (NCBI)