Products 1567052-17-8
CAS 1567052-17-8 is the registry number for 2,3,5-Trimethylpyrazolo(1,5-a)pyrimidine-7-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2,3,5-trimethylpyrazolo[1,5-a]pyrimidine-7-carboxylic acid (CAS 1567052-17-8) is a chemical compound with the molecular formula C10H11N3O2 and a molecular weight of 205.21 g/mol. IUPAC name: 2,3,5-trimethylpyrazolo[1,5-a]pyrimidine-7-carboxylic acid. InChIKey: LUOPTAUGRZALFJ-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O2 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | 2,3,5-trimethylpyrazolo[1,5-a]pyrimidine-7-carboxylic acid |
| InChIKey | LUOPTAUGRZALFJ-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C(=NN2C(=C1)C(=O)O)C)C |
Computed by PubChem (NCBI)