CAS 1567894-76-1 is the registry number for (R)-1-(5-Bromo-2-fluorophenyl)ethan-1-ol, 98%. Offered by: AmBeed. Available pack sizes: 5g, 50mg.
(1R)-1-(5-bromo-2-fluorophenyl)ethanol (CAS 1567894-76-1) is a chemical compound with the molecular formula C8H8BrFO and a molecular weight of 219.05 g/mol. IUPAC name: (1R)-1-(5-bromo-2-fluorophenyl)ethanol. InChIKey: QWIJUQVYIYCHMK-RXMQYKEDSA-N.
| Molecular formula | C8H8BrFO |
|---|---|
| Molecular weight | 219.05 g/mol |
| IUPAC name | (1R)-1-(5-bromo-2-fluorophenyl)ethanol |
| InChIKey | QWIJUQVYIYCHMK-RXMQYKEDSA-N |
| SMILES | C[C@H](C1=C(C=CC(=C1)Br)F)O |
Computed by PubChem (NCBI)