CAS 1568019-01-1 is the registry number for (1,2,3-Thiadiazole-5-carbonyl)-D-valine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-3-methyl-2-(thiadiazole-5-carbonylamino)butanoic acid (CAS 1568019-01-1) is a chemical compound with the molecular formula C8H11N3O3S and a molecular weight of 229.26 g/mol. IUPAC name: (2R)-3-methyl-2-(thiadiazole-5-carbonylamino)butanoic acid. InChIKey: PTRIVZZCQGIBID-ZCFIWIBFSA-N.
| Molecular formula | C8H11N3O3S |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | (2R)-3-methyl-2-(thiadiazole-5-carbonylamino)butanoic acid |
| InChIKey | PTRIVZZCQGIBID-ZCFIWIBFSA-N |
| SMILES | CC(C)[C@H](C(=O)O)NC(=O)C1=CN=NS1 |
Computed by PubChem (NCBI)