Products 1568237-40-0
CAS 1568237-40-0 is the registry number for (1S)-7-(Propan-2-yloxy)-1,2,3,4-tetrahydronaphthalen-1-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(1S)-7-propan-2-yloxy-1,2,3,4-tetrahydronaphthalen-1-ol (CAS 1568237-40-0) is a chemical compound with the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. IUPAC name: (1S)-7-propan-2-yloxy-1,2,3,4-tetrahydronaphthalen-1-ol. InChIKey: HLTQZBOYDYKIRP-ZDUSSCGKSA-N.
| Molecular formula | C13H18O2 |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | (1S)-7-propan-2-yloxy-1,2,3,4-tetrahydronaphthalen-1-ol |
| InChIKey | HLTQZBOYDYKIRP-ZDUSSCGKSA-N |
| SMILES | CC(C)OC1=CC2=C(CCC[C@@H]2O)C=C1 |
Computed by PubChem (NCBI)