Products 1568970-44-4
CAS 1568970-44-4 is the registry number for 4-(1,4-Diazepane-1-carbonyl)benzonitrile hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(1,4-diazepane-1-carbonyl)benzonitrile;hydrochloride (CAS 1568970-44-4) is a chemical compound with the molecular formula C13H16ClN3O and a molecular weight of 265.74 g/mol. IUPAC name: 4-(1,4-diazepane-1-carbonyl)benzonitrile;hydrochloride. InChIKey: XVOFQOFSHSIZHM-UHFFFAOYSA-N.
| Molecular formula | C13H16ClN3O |
|---|---|
| Molecular weight | 265.74 g/mol |
| IUPAC name | 4-(1,4-diazepane-1-carbonyl)benzonitrile;hydrochloride |
| InChIKey | XVOFQOFSHSIZHM-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)C(=O)C2=CC=C(C=C2)C#N.Cl |
Computed by PubChem (NCBI)