Products 1574675-46-9
CAS 1574675-46-9 is the registry number for (1H-Indol-7-yl)(piperazin-1-yl)methanone hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1H-indol-7-yl(piperazin-1-yl)methanone;hydrochloride (CAS 1574675-46-9) is a chemical compound with the molecular formula C13H16ClN3O and a molecular weight of 265.74 g/mol. IUPAC name: 1H-indol-7-yl(piperazin-1-yl)methanone;hydrochloride. InChIKey: PNBLFTPXSTXNCK-UHFFFAOYSA-N.
| Molecular formula | C13H16ClN3O |
|---|---|
| Molecular weight | 265.74 g/mol |
| IUPAC name | 1H-indol-7-yl(piperazin-1-yl)methanone;hydrochloride |
| InChIKey | PNBLFTPXSTXNCK-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)C2=CC=CC3=C2NC=C3.Cl |
Computed by PubChem (NCBI)