CAS 156928-09-5 appears in our catalog under these names: (3R,3aS,6aR)-hexahydrofuro[2,3-b]furan-3-ol, 97%, (3R,3aS,6aR)-Hexahydrofuro(2,3-b)furan-3-ol, (3R,3aS,6aR)–Hexahydrofuro(2,3–b)furan–3–ol, (3R,3aS,6aR)-Hexahydrofuro[2,3-b]furan-3-ol 97%, (3R,3aS,6aR)-Hexahydrofuro[2,3-b]furan-3-ol, 97%, 97%. Offered by: Combi-blocks, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 1g, 2,5g, 250mg, 25g, 100g.
(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-ol (CAS 156928-09-5) is a chemical compound with the molecular formula C6H10O3 and a molecular weight of 130.14 g/mol. IUPAC name: (3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-ol. InChIKey: RCDXYCHYMULCDZ-HCWXCVPCSA-N.
| Molecular formula | C6H10O3 |
|---|---|
| Molecular weight | 130.14 g/mol |
| IUPAC name | (3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-ol |
| InChIKey | RCDXYCHYMULCDZ-HCWXCVPCSA-N |
| SMILES | C1CO[C@H]2[C@@H]1[C@H](CO2)O |
Computed by PubChem (NCBI)