CAS 156928-10-8 appears in our catalog under these names: Bisfuranol Impurity 1, (3S,3aR,6aS)-Hexahydrofuro(2,3-b)furan-3-ol. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg.
(3aR,4S,6aS)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-ol (CAS 156928-10-8) is a chemical compound with the molecular formula C6H10O3 and a molecular weight of 130.14 g/mol. IUPAC name: (3aR,4S,6aS)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-ol. InChIKey: RCDXYCHYMULCDZ-PBXRRBTRSA-N.
| Molecular formula | C6H10O3 |
|---|---|
| Molecular weight | 130.14 g/mol |
| IUPAC name | (3aR,4S,6aS)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-ol |
| InChIKey | RCDXYCHYMULCDZ-PBXRRBTRSA-N |
| SMILES | C1CO[C@@H]2[C@H]1[C@@H](CO2)O |
Computed by PubChem (NCBI)