CAS 1569524-37-3 is the registry number for Potassium Trifluoro(3-methoxybenzyl)borate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Potassium trifluoro-[(3-methoxyphenyl)methyl]boranuide (CAS 1569524-37-3) is a chemical compound with the molecular formula C8H9BF3KO and a molecular weight of 228.06 g/mol. IUPAC name: potassium trifluoro-[(3-methoxyphenyl)methyl]boranuide. InChIKey: BZVSSPPRCLXJOI-UHFFFAOYSA-N.
| Molecular formula | C8H9BF3KO |
|---|---|
| Molecular weight | 228.06 g/mol |
| IUPAC name | potassium trifluoro-[(3-methoxyphenyl)methyl]boranuide |
| InChIKey | BZVSSPPRCLXJOI-UHFFFAOYSA-N |
| SMILES | [B-](CC1=CC(=CC=C1)OC)(F)(F)F.[K+] |
Computed by PubChem (NCBI)