CAS 1707202-87-6 is the registry number for Potassium trifluoro(2-methoxybenzyl)borate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Potassium trifluoro-[(2-methoxyphenyl)methyl]boranuide (CAS 1707202-87-6) is a chemical compound with the molecular formula C8H9BF3KO and a molecular weight of 228.06 g/mol. IUPAC name: potassium trifluoro-[(2-methoxyphenyl)methyl]boranuide. InChIKey: CKSOATXYEPQWKA-UHFFFAOYSA-N.
| Molecular formula | C8H9BF3KO |
|---|---|
| Molecular weight | 228.06 g/mol |
| IUPAC name | potassium trifluoro-[(2-methoxyphenyl)methyl]boranuide |
| InChIKey | CKSOATXYEPQWKA-UHFFFAOYSA-N |
| SMILES | [B-](CC1=CC=CC=C1OC)(F)(F)F.[K+] |
Computed by PubChem (NCBI)