CAS 157037-56-4 appears in our catalog under these names: Sofosbuvir Impurity 87, 1,3,5-Tri-O-benzoyl-2-keto-a-D-ribofuranose. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 1g, 0,5g, 5g.
[(2R,3R,5R)-3,5-dibenzoyloxy-4-oxooxolan-2-yl]methyl benzoate (CAS 157037-56-4) is a chemical compound with the molecular formula C26H20O8 and a molecular weight of 460.4 g/mol. IUPAC name: [(2R,3R,5R)-3,5-dibenzoyloxy-4-oxooxolan-2-yl]methyl benzoate. InChIKey: XNTDXEVKPQUSSA-RQNQAMLKSA-N.
| Molecular formula | C26H20O8 |
|---|---|
| Molecular weight | 460.4 g/mol |
| IUPAC name | [(2R,3R,5R)-3,5-dibenzoyloxy-4-oxooxolan-2-yl]methyl benzoate |
| InChIKey | XNTDXEVKPQUSSA-RQNQAMLKSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC[C@@H]2[C@H](C(=O)[C@H](O2)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)