CAS 2248462-00-0 appears in our catalog under these names: 4,4',4'',4'''-(Ethene-1,1,2,2-tetrayl)tetrakis(benzene-1,2-diol), 97%, 97%, 4,4',4'',4'''-(Ethene-1,1,2,2-tetrayl)tetrakis(benzene-1,2-diol), 97%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
4-[1,2,2-tris(3,4-dihydroxyphenyl)ethenyl]benzene-1,2-diol (CAS 2248462-00-0) is a chemical compound with the molecular formula C26H20O8 and a molecular weight of 460.4 g/mol. IUPAC name: 4-[1,2,2-tris(3,4-dihydroxyphenyl)ethenyl]benzene-1,2-diol. InChIKey: RFMOFACAYXGGLB-UHFFFAOYSA-N.
| Molecular formula | C26H20O8 |
|---|---|
| Molecular weight | 460.4 g/mol |
| IUPAC name | 4-[1,2,2-tris(3,4-dihydroxyphenyl)ethenyl]benzene-1,2-diol |
| InChIKey | RFMOFACAYXGGLB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=C(C2=CC(=C(C=C2)O)O)C3=CC(=C(C=C3)O)O)C4=CC(=C(C=C4)O)O)O)O |
Computed by PubChem (NCBI)