Products 157097-10-4
CAS 157097-10-4 is the registry number for RLH-033. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(4-phenylpiperidin-1-yl)ethyl 1-(4-nitrophenyl)cyclopentane-1-carboxylate;hydrochloride (CAS 157097-10-4) is a chemical compound with the molecular formula C25H31ClN2O4 and a molecular weight of 459.0 g/mol. IUPAC name: 2-(4-phenylpiperidin-1-yl)ethyl 1-(4-nitrophenyl)cyclopentane-1-carboxylate;hydrochloride. InChIKey: RQQAHFSSIAWEPI-UHFFFAOYSA-N.
| Molecular formula | C25H31ClN2O4 |
|---|---|
| Molecular weight | 459.0 g/mol |
| IUPAC name | 2-(4-phenylpiperidin-1-yl)ethyl 1-(4-nitrophenyl)cyclopentane-1-carboxylate;hydrochloride |
| InChIKey | RQQAHFSSIAWEPI-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC=C(C=C2)[N+](=O)[O-])C(=O)OCCN3CCC(CC3)C4=CC=CC=C4.Cl |
Computed by PubChem (NCBI)