Products 1573029-17-0
CAS 1573029-17-0 is the registry number for THK-523. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[6-(2-fluoroethoxy)quinolin-2-yl]aniline (CAS 1573029-17-0) is a chemical compound with the molecular formula C17H15FN2O and a molecular weight of 282.31 g/mol. IUPAC name: 4-[6-(2-fluoroethoxy)quinolin-2-yl]aniline. InChIKey: ZGJOXECWZKCGBV-UHFFFAOYSA-N.
| Molecular formula | C17H15FN2O |
|---|---|
| Molecular weight | 282.31 g/mol |
| IUPAC name | 4-[6-(2-fluoroethoxy)quinolin-2-yl]aniline |
| InChIKey | ZGJOXECWZKCGBV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC3=C(C=C2)C=C(C=C3)OCCF)N |
Computed by PubChem (NCBI)