CAS 1573118-32-7 is the registry number for Alogliptin Impurity 55. Offered by: Chemat Brand. Available pack sizes: on request.
5-methyl-2-[(3R)-piperidin-3-yl]isoindole-1,3-dione (CAS 1573118-32-7) is a chemical compound with the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. IUPAC name: 5-methyl-2-[(3R)-piperidin-3-yl]isoindole-1,3-dione. InChIKey: YGASESJVYOTZIC-SNVBAGLBSA-N.
| Molecular formula | C14H16N2O2 |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | 5-methyl-2-[(3R)-piperidin-3-yl]isoindole-1,3-dione |
| InChIKey | YGASESJVYOTZIC-SNVBAGLBSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=O)N(C2=O)[C@@H]3CCCNC3 |
Computed by PubChem (NCBI)