Products 157444-69-4

CAS 157444-69-4 appears in our catalog under these names: methyl 2–(4–(tert–butyl)phenyl)–2–methylpropanoate, 2-(4-tert-Butyl-phenyl)-2-methyl-propionic acid methyl ester, 95%, 2-(4-tert-Butyl-phenyl)-2-methyl-propionic acid methyl ester. Offered by: GLPBio, Combi-blocks, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 2-(4-tert-butylphenyl)-2-methylpropanoate (CAS 157444-69-4) is a chemical compound with the molecular formula C15H22O2 and a molecular weight of 234.33 g/mol. IUPAC name: methyl 2-(4-tert-butylphenyl)-2-methylpropanoate. InChIKey: MFQRFTBOTSBMIO-UHFFFAOYSA-N.

Identity
Molecular formulaC15H22O2
Molecular weight234.33 g/mol
IUPAC namemethyl 2-(4-tert-butylphenyl)-2-methylpropanoate
InChIKeyMFQRFTBOTSBMIO-UHFFFAOYSA-N
SMILESCC(C)(C)C1=CC=C(C=C1)C(C)(C)C(=O)OC

Computed by PubChem (NCBI)