CAS 15754-51-5 appears in our catalog under these names: Bis(4-methoxyphenyl)phosphine Oxide, >98.0%(HPLC)(qNMR), Bis(4-methoxyphenyl)phosphine oxide 95%, Bis(4-methoxyphenyl)phosphine oxide, 96%. Offered by: TCI, Ambeed, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 25g, 100g, 10g.
Bis(4-methoxyphenyl)-oxophosphanium (CAS 15754-51-5) is a chemical compound with the molecular formula C14H14O3P+ and a molecular weight of 261.23 g/mol. IUPAC name: bis(4-methoxyphenyl)-oxophosphanium. InChIKey: RREGWFNURZJKNB-UHFFFAOYSA-N.
| Molecular formula | C14H14O3P+ |
|---|---|
| Molecular weight | 261.23 g/mol |
| IUPAC name | bis(4-methoxyphenyl)-oxophosphanium |
| InChIKey | RREGWFNURZJKNB-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)[P+](=O)C2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)