CAS 1575569-69-5 appears in our catalog under these names: Imidacloprid Impurity 20, (C(E))-N-((6-Chloro-3-pyridinyl)methyl)-N'-nitro-guanidine. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
1-[(6-chloro-3-pyridinyl)methyl]-2-nitroguanidine (CAS 1575569-69-5) is a chemical compound with the molecular formula C7H8ClN5O2 and a molecular weight of 229.62 g/mol. IUPAC name: 1-[(6-chloro-3-pyridinyl)methyl]-2-nitroguanidine. InChIKey: GHBBFPGYBPOUCF-UHFFFAOYSA-N.
| Molecular formula | C7H8ClN5O2 |
|---|---|
| Molecular weight | 229.62 g/mol |
| IUPAC name | 1-[(6-chloro-3-pyridinyl)methyl]-2-nitroguanidine |
| InChIKey | GHBBFPGYBPOUCF-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1CN/C(=N/[N+](=O)[O-])/N)Cl |
Computed by PubChem (NCBI)