CAS 98276-29-0 appears in our catalog under these names: 4-Chloropyridine-2,6-dicarbohydrazide, 4-Chloropyridine-2,6-dicarbohydrazide, 97%. Offered by: TRC, AmBeed. Available pack sizes: 2,5g, 1g.
4-chloropyridine-2,6-dicarbohydrazide (CAS 98276-29-0) is a chemical compound with the molecular formula C7H8ClN5O2 and a molecular weight of 229.62 g/mol. IUPAC name: 4-chloropyridine-2,6-dicarbohydrazide. InChIKey: BNEZLSRZGGPXAG-UHFFFAOYSA-N.
| Molecular formula | C7H8ClN5O2 |
|---|---|
| Molecular weight | 229.62 g/mol |
| IUPAC name | 4-chloropyridine-2,6-dicarbohydrazide |
| InChIKey | BNEZLSRZGGPXAG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1C(=O)NN)C(=O)NN)Cl |
Computed by PubChem (NCBI)