Products 1575836-76-8
CAS 1575836-76-8 is the registry number for tert-Butyl 2'-chloro-7'H-spiro[azetidine-3,5'-furo[3,4-b]pyridine]-1-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2-chlorospiro[7H-furo[3,4-b]pyridine-5,3'-azetidine]-1'-carboxylate (CAS 1575836-76-8) is a chemical compound with the molecular formula C14H17ClN2O3 and a molecular weight of 296.75 g/mol. IUPAC name: tert-butyl 2-chlorospiro[7H-furo[3,4-b]pyridine-5,3'-azetidine]-1'-carboxylate. InChIKey: GPLANVBEEVVDCW-UHFFFAOYSA-N.
| Molecular formula | C14H17ClN2O3 |
|---|---|
| Molecular weight | 296.75 g/mol |
| IUPAC name | tert-butyl 2-chlorospiro[7H-furo[3,4-b]pyridine-5,3'-azetidine]-1'-carboxylate |
| InChIKey | GPLANVBEEVVDCW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)C3=C(CO2)N=C(C=C3)Cl |
Computed by PubChem (NCBI)