Products 2796343-75-2
CAS 2796343-75-2 is the registry number for tert-Butyl 2-chloro-7-formyl-7,8-dihydro-1,6-naphthyridine-6(5H)-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2-chloro-7-formyl-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate (CAS 2796343-75-2) is a chemical compound with the molecular formula C14H17ClN2O3 and a molecular weight of 296.75 g/mol. IUPAC name: tert-butyl 2-chloro-7-formyl-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate. InChIKey: NRRADXDSPCCCRF-UHFFFAOYSA-N.
| Molecular formula | C14H17ClN2O3 |
|---|---|
| Molecular weight | 296.75 g/mol |
| IUPAC name | tert-butyl 2-chloro-7-formyl-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate |
| InChIKey | NRRADXDSPCCCRF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(CC1C=O)N=C(C=C2)Cl |
Computed by PubChem (NCBI)