CAS 1350759-92-0 is the registry number for 4-(1-Oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl)benzoic acid hydrochloride, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl)benzoic acid;hydrochloride (CAS 1350759-92-0) is a chemical compound with the molecular formula C14H17ClN2O3 and a molecular weight of 296.75 g/mol. IUPAC name: 4-(1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl)benzoic acid;hydrochloride. InChIKey: SLAHNPOFPBUIHI-UHFFFAOYSA-N.
| Molecular formula | C14H17ClN2O3 |
|---|---|
| Molecular weight | 296.75 g/mol |
| IUPAC name | 4-(1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl)benzoic acid;hydrochloride |
| InChIKey | SLAHNPOFPBUIHI-UHFFFAOYSA-N |
| SMILES | C1CNCCC12CC(=NO2)C3=CC=C(C=C3)C(=O)O.Cl |
Computed by PubChem (NCBI)