CAS 157594-60-0 is the registry number for (R)-di-tert-butyl 2-hydroxysuccinate, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
Ditert-butyl (2R)-2-hydroxybutanedioate (CAS 157594-60-0) is a chemical compound with the molecular formula C12H22O5 and a molecular weight of 246.30 g/mol. IUPAC name: ditert-butyl (2R)-2-hydroxybutanedioate. InChIKey: GINKKVHSVSLTAV-MRVPVSSYSA-N.
| Molecular formula | C12H22O5 |
|---|---|
| Molecular weight | 246.30 g/mol |
| IUPAC name | ditert-butyl (2R)-2-hydroxybutanedioate |
| InChIKey | GINKKVHSVSLTAV-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@H](C(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)