Products 355126-91-9
CAS 355126-91-9 appears in our catalog under these names: (S)-Di-tert-butyl 2-hydroxysuccinate, 95%, (S)-Di-tert-butyl 2-hydroxysuccinate, 97%, (S)-Di-tert-butyl 2-hydroxysuccinate, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
Ditert-butyl (2S)-2-hydroxybutanedioate (CAS 355126-91-9) is a chemical compound with the molecular formula C12H22O5 and a molecular weight of 246.30 g/mol. IUPAC name: ditert-butyl (2S)-2-hydroxybutanedioate. InChIKey: GINKKVHSVSLTAV-QMMMGPOBSA-N.
| Molecular formula | C12H22O5 |
|---|---|
| Molecular weight | 246.30 g/mol |
| IUPAC name | ditert-butyl (2S)-2-hydroxybutanedioate |
| InChIKey | GINKKVHSVSLTAV-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@@H](C(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)