CAS 157610-58-7 is the registry number for 4-(((tert-Butyl)dimethylsilyl)oxy)phenacyl Bromide. Offered by: TRC. Available pack sizes: 5g.
2-bromo-1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]ethanone (CAS 157610-58-7) is a chemical compound with the molecular formula C14H21BrO2Si and a molecular weight of 329.30 g/mol. IUPAC name: 2-bromo-1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]ethanone. InChIKey: KJQPTJRQSPGZSM-UHFFFAOYSA-N.
| Molecular formula | C14H21BrO2Si |
|---|---|
| Molecular weight | 329.30 g/mol |
| IUPAC name | 2-bromo-1-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]ethanone |
| InChIKey | KJQPTJRQSPGZSM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1=CC=C(C=C1)C(=O)CBr |
Computed by PubChem (NCBI)