CAS 2679763-52-9 is the registry number for 2-(3-Bromo-2-((tert-butyldimethylsilyl)oxy)phenyl)acetaldehyde, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[3-bromo-2-[tert-butyl(dimethyl)silyl]oxyphenyl]acetaldehyde (CAS 2679763-52-9) is a chemical compound with the molecular formula C14H21BrO2Si and a molecular weight of 329.30 g/mol. IUPAC name: 2-[3-bromo-2-[tert-butyl(dimethyl)silyl]oxyphenyl]acetaldehyde. InChIKey: PEQCSBZELWDKJS-UHFFFAOYSA-N.
| Molecular formula | C14H21BrO2Si |
|---|---|
| Molecular weight | 329.30 g/mol |
| IUPAC name | 2-[3-bromo-2-[tert-butyl(dimethyl)silyl]oxyphenyl]acetaldehyde |
| InChIKey | PEQCSBZELWDKJS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1=C(C=CC=C1Br)CC=O |
Computed by PubChem (NCBI)