Products 15763-02-7

CAS 15763-02-7 is the registry number for Dioctyl 2-hydroxysuccinate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Dioctyl 2-hydroxybutanedioate (CAS 15763-02-7) is a chemical compound with the molecular formula C20H38O5 and a molecular weight of 358.5 g/mol. IUPAC name: dioctyl 2-hydroxybutanedioate. InChIKey: CNHQWLUGXFIDAT-UHFFFAOYSA-N.

Identity
Molecular formulaC20H38O5
Molecular weight358.5 g/mol
IUPAC namedioctyl 2-hydroxybutanedioate
InChIKeyCNHQWLUGXFIDAT-UHFFFAOYSA-N
SMILESCCCCCCCCOC(=O)CC(C(=O)OCCCCCCCC)O

Computed by PubChem (NCBI)