Products 72269-52-4

CAS 72269-52-4 is the registry number for Diethylene glycol bis(2-ethylhexanoate), 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

2-[2-(2-ethylhexanoyloxy)ethoxy]ethyl 2-ethylhexanoate (CAS 72269-52-4) is a chemical compound with the molecular formula C20H38O5 and a molecular weight of 358.5 g/mol. IUPAC name: 2-[2-(2-ethylhexanoyloxy)ethoxy]ethyl 2-ethylhexanoate. InChIKey: GWQRPOCMBMQBTK-UHFFFAOYSA-N.

Identity
Molecular formulaC20H38O5
Molecular weight358.5 g/mol
IUPAC name2-[2-(2-ethylhexanoyloxy)ethoxy]ethyl 2-ethylhexanoate
InChIKeyGWQRPOCMBMQBTK-UHFFFAOYSA-N
SMILESCCCCC(CC)C(=O)OCCOCCOC(=O)C(CC)CCCC

Computed by PubChem (NCBI)