CAS 1577102-34-1 appears in our catalog under these names: 1-(3-(Aminomethyl)piperidin-1-yl)-2,2,2-trifluoroethan-1-one hydrochloride, 1-(3-(aminomethyl)piperidin-1-yl)-2,2,2-trifluoroethan-1-one hydrochloride, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 0,5g, 5g, 1g, 10g, 250mg, 100mg.
1-[3-(aminomethyl)piperidin-1-yl]-2,2,2-trifluoroethanone;hydrochloride (CAS 1577102-34-1) is a chemical compound with the molecular formula C8H14ClF3N2O and a molecular weight of 246.66 g/mol. IUPAC name: 1-[3-(aminomethyl)piperidin-1-yl]-2,2,2-trifluoroethanone;hydrochloride. InChIKey: NBIGDSRWNXLDEH-UHFFFAOYSA-N.
| Molecular formula | C8H14ClF3N2O |
|---|---|
| Molecular weight | 246.66 g/mol |
| IUPAC name | 1-[3-(aminomethyl)piperidin-1-yl]-2,2,2-trifluoroethanone;hydrochloride |
| InChIKey | NBIGDSRWNXLDEH-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C(=O)C(F)(F)F)CN.Cl |
Computed by PubChem (NCBI)