Products 1605121-55-8
CAS 1605121-55-8 is the registry number for 3,3,3-Trifluoro-N-((3S)-piperidin-3-yl)propanamide hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3,3,3-trifluoro-N-[(3S)-piperidin-3-yl]propanamide;hydrochloride (CAS 1605121-55-8) is a chemical compound with the molecular formula C8H14ClF3N2O and a molecular weight of 246.66 g/mol. IUPAC name: 3,3,3-trifluoro-N-[(3S)-piperidin-3-yl]propanamide;hydrochloride. InChIKey: QZVYGBKBPBJAJO-RGMNGODLSA-N.
| Molecular formula | C8H14ClF3N2O |
|---|---|
| Molecular weight | 246.66 g/mol |
| IUPAC name | 3,3,3-trifluoro-N-[(3S)-piperidin-3-yl]propanamide;hydrochloride |
| InChIKey | QZVYGBKBPBJAJO-RGMNGODLSA-N |
| SMILES | C1C[C@@H](CNC1)NC(=O)CC(F)(F)F.Cl |
Computed by PubChem (NCBI)