CAS 157717-57-2 is the registry number for (R)-4,4-Dimethyl-2-oxotetrahydrofuran-3-yl trifluoromethanesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(3R)-4,4-dimethyl-2-oxooxolan-3-yl] trifluoromethanesulfonate (CAS 157717-57-2) is a chemical compound with the molecular formula C7H9F3O5S and a molecular weight of 262.21 g/mol. IUPAC name: [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] trifluoromethanesulfonate. InChIKey: XMEVZEMJXYDCFH-BYPYZUCNSA-N.
| Molecular formula | C7H9F3O5S |
|---|---|
| Molecular weight | 262.21 g/mol |
| IUPAC name | [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] trifluoromethanesulfonate |
| InChIKey | XMEVZEMJXYDCFH-BYPYZUCNSA-N |
| SMILES | CC1(COC(=O)[C@@H]1OS(=O)(=O)C(F)(F)F)C |
Computed by PubChem (NCBI)