CAS 2843587-05-1 is the registry number for 6-Methoxy-5,6-dihydro-2H-pyran-3-yl trifluoromethanesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2-methoxy-3,6-dihydro-2H-pyran-5-yl) trifluoromethanesulfonate (CAS 2843587-05-1) is a chemical compound with the molecular formula C7H9F3O5S and a molecular weight of 262.21 g/mol. IUPAC name: (2-methoxy-3,6-dihydro-2H-pyran-5-yl) trifluoromethanesulfonate. InChIKey: UGTPZAUKTOIFAR-UHFFFAOYSA-N.
| Molecular formula | C7H9F3O5S |
|---|---|
| Molecular weight | 262.21 g/mol |
| IUPAC name | (2-methoxy-3,6-dihydro-2H-pyran-5-yl) trifluoromethanesulfonate |
| InChIKey | UGTPZAUKTOIFAR-UHFFFAOYSA-N |
| SMILES | COC1CC=C(CO1)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)