Products 1577254-94-4
CAS 1577254-94-4 is the registry number for 3-(Dimethylamino)-2-(pyridin-2-yl)prop-2-enenitrile. Offered by: Biosynth. Available pack sizes: 1g, 10g.
(E)-3-(dimethylamino)-2-pyridin-2-ylprop-2-enenitrile (CAS 1577254-94-4) is a chemical compound with the molecular formula C10H11N3 and a molecular weight of 173.21 g/mol. IUPAC name: (E)-3-(dimethylamino)-2-pyridin-2-ylprop-2-enenitrile. InChIKey: HQVNVYFIPYMSHH-HJWRWDBZSA-N.
| Molecular formula | C10H11N3 |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | (E)-3-(dimethylamino)-2-pyridin-2-ylprop-2-enenitrile |
| InChIKey | HQVNVYFIPYMSHH-HJWRWDBZSA-N |
| SMILES | CN(C)/C=C(/C#N)\C1=CC=CC=N1 |
Computed by PubChem (NCBI)