CAS 15773-96-3 appears in our catalog under these names: 6,8-Dibromo-2,3-dihydrochromen-4-one, 95%, 6,8–Dibromochroman–4–one, 6,8-Dibromochroman-4-one, 98%, 98%, 6,8-Dibromochroman-4-one, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
6,8-dibromo-2,3-dihydrochromen-4-one (CAS 15773-96-3) is a chemical compound with the molecular formula C9H6Br2O2 and a molecular weight of 305.95 g/mol. IUPAC name: 6,8-dibromo-2,3-dihydrochromen-4-one. InChIKey: NPVIVRRXGMSKTH-UHFFFAOYSA-N.
| Molecular formula | C9H6Br2O2 |
|---|---|
| Molecular weight | 305.95 g/mol |
| IUPAC name | 6,8-dibromo-2,3-dihydrochromen-4-one |
| InChIKey | NPVIVRRXGMSKTH-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1=O)C=C(C=C2Br)Br |
Computed by PubChem (NCBI)