CAS 42974-18-5 appears in our catalog under these names: 3,4-Dibromo-chroman-2-one, 95%, 3,4-Dibromochroman-2-one, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
3,4-dibromo-3,4-dihydrochromen-2-one (CAS 42974-18-5) is a chemical compound with the molecular formula C9H6Br2O2 and a molecular weight of 305.95 g/mol. IUPAC name: 3,4-dibromo-3,4-dihydrochromen-2-one. InChIKey: KJKAAETZDLJFKU-UHFFFAOYSA-N.
| Molecular formula | C9H6Br2O2 |
|---|---|
| Molecular weight | 305.95 g/mol |
| IUPAC name | 3,4-dibromo-3,4-dihydrochromen-2-one |
| InChIKey | KJKAAETZDLJFKU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C(C(=O)O2)Br)Br |
Computed by PubChem (NCBI)