CAS 157752-20-0 is the registry number for CB-64D. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1R,5R,8E)-8-benzylidene-5-(3-hydroxyphenyl)-2-methyl-2-azabicyclo[3.3.1]nonan-7-one (CAS 157752-20-0) is a chemical compound with the molecular formula C22H23NO2 and a molecular weight of 333.4 g/mol. IUPAC name: (1R,5R,8E)-8-benzylidene-5-(3-hydroxyphenyl)-2-methyl-2-azabicyclo[3.3.1]nonan-7-one. InChIKey: YVMTWTZIAIUURI-VQSNLYSRSA-N.
| Molecular formula | C22H23NO2 |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | (1R,5R,8E)-8-benzylidene-5-(3-hydroxyphenyl)-2-methyl-2-azabicyclo[3.3.1]nonan-7-one |
| InChIKey | YVMTWTZIAIUURI-VQSNLYSRSA-N |
| SMILES | CN1CC[C@]2(C[C@@H]1/C(=C\C3=CC=CC=C3)/C(=O)C2)C4=CC(=CC=C4)O |
Computed by PubChem (NCBI)