CAS 157763-14-9 appears in our catalog under these names: 2-(1,3-Benzothiazol-2-yl)propan-2-amine, 95%, 2-(1,3-Benzothiazol-2-yl)propan-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(1,3-benzothiazol-2-yl)propan-2-amine (CAS 157763-14-9) is a chemical compound with the molecular formula C10H12N2S and a molecular weight of 192.28 g/mol. IUPAC name: 2-(1,3-benzothiazol-2-yl)propan-2-amine. InChIKey: HPJUFYLPIBFGMA-UHFFFAOYSA-N.
| Molecular formula | C10H12N2S |
|---|---|
| Molecular weight | 192.28 g/mol |
| IUPAC name | 2-(1,3-benzothiazol-2-yl)propan-2-amine |
| InChIKey | HPJUFYLPIBFGMA-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=NC2=CC=CC=C2S1)N |
Computed by PubChem (NCBI)