CAS 1578484-84-0 is the registry number for 3-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl)butan-2-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]butan-2-one (CAS 1578484-84-0) is a chemical compound with the molecular formula C13H21BN2O3 and a molecular weight of 264.13 g/mol. IUPAC name: 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]butan-2-one. InChIKey: CGOPQNLNXHVKHO-UHFFFAOYSA-N.
| Molecular formula | C13H21BN2O3 |
|---|---|
| Molecular weight | 264.13 g/mol |
| IUPAC name | 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]butan-2-one |
| InChIKey | CGOPQNLNXHVKHO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)C(C)C(=O)C |
Computed by PubChem (NCBI)