CAS 2223006-52-6 is the registry number for 1-(Tetrahydrofuran-3-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(oxolan-3-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 2223006-52-6) is a chemical compound with the molecular formula C13H21BN2O3 and a molecular weight of 264.13 g/mol. IUPAC name: 1-(oxolan-3-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: HCWAZERNMZJKPK-UHFFFAOYSA-N.
| Molecular formula | C13H21BN2O3 |
|---|---|
| Molecular weight | 264.13 g/mol |
| IUPAC name | 1-(oxolan-3-yl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | HCWAZERNMZJKPK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NN(C=C2)C3CCOC3 |
Computed by PubChem (NCBI)