CAS 157947-07-4 is the registry number for (R)-1-(4-Aminophenyl)-2,2,2-trifluoroethan-1-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(1R)-1-(4-aminophenyl)-2,2,2-trifluoroethanol (CAS 157947-07-4) is a chemical compound with the molecular formula C8H8F3NO and a molecular weight of 191.15 g/mol. IUPAC name: (1R)-1-(4-aminophenyl)-2,2,2-trifluoroethanol. InChIKey: MXJOUBNXCFLFBS-SSDOTTSWSA-N.
| Molecular formula | C8H8F3NO |
|---|---|
| Molecular weight | 191.15 g/mol |
| IUPAC name | (1R)-1-(4-aminophenyl)-2,2,2-trifluoroethanol |
| InChIKey | MXJOUBNXCFLFBS-SSDOTTSWSA-N |
| SMILES | C1=CC(=CC=C1[C@H](C(F)(F)F)O)N |
Computed by PubChem (NCBI)