CAS 158001-18-4 is the registry number for 5-Amino-1-tert-butyl-3-phenylmethyl-4-cyanopyrazole. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
5-amino-3-benzyl-1-tert-butylpyrazole-4-carbonitrile (CAS 158001-18-4) is a chemical compound with the molecular formula C15H18N4 and a molecular weight of 254.33 g/mol. IUPAC name: 5-amino-3-benzyl-1-tert-butylpyrazole-4-carbonitrile. InChIKey: BUSKUEBIZUJLMJ-UHFFFAOYSA-N.
| Molecular formula | C15H18N4 |
|---|---|
| Molecular weight | 254.33 g/mol |
| IUPAC name | 5-amino-3-benzyl-1-tert-butylpyrazole-4-carbonitrile |
| InChIKey | BUSKUEBIZUJLMJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C(=C(C(=N1)CC2=CC=CC=C2)C#N)N |
Computed by PubChem (NCBI)