CAS 77359-18-3 appears in our catalog under these names: (1E)-1-(2-Methylphenyl)ethanone 2-(4,6-dimethyl-2-pyrimidinyl)hydrazone, (E)-Ferimzone. Offered by: TRC, Dr. Ehrenstorfer, HPC Standards. Available pack sizes: 250mg, 10mg, 1x10mg.
4,6-dimethyl-N-[(E)-1-(2-methylphenyl)ethylideneamino]pyrimidin-2-amine (CAS 77359-18-3) is a chemical compound with the molecular formula C15H18N4 and a molecular weight of 254.33 g/mol. IUPAC name: 4,6-dimethyl-N-[(E)-1-(2-methylphenyl)ethylideneamino]pyrimidin-2-amine. InChIKey: GOWLARCWZRESHU-QGOAFFKASA-N.
| Molecular formula | C15H18N4 |
|---|---|
| Molecular weight | 254.33 g/mol |
| IUPAC name | 4,6-dimethyl-N-[(E)-1-(2-methylphenyl)ethylideneamino]pyrimidin-2-amine |
| InChIKey | GOWLARCWZRESHU-QGOAFFKASA-N |
| SMILES | CC1=CC=CC=C1/C(=N/NC2=NC(=CC(=N2)C)C)/C |
Computed by PubChem (NCBI)